C12H21N5O — CID 143469327
3-amino-8-octyl-1,2,4,8-tetrazabicyclo[4.2.0]octa-2,6-dien-5-one (PubChem CID 143469327) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-amino-8-octyl-1,2,4,8-tetrazabicyclo[4.2.0]octa-2,6-dien-5-one.
| Compound Name | 3-amino-8-octyl-1,2,4,8-tetrazabicyclo[4.2.0]octa-2,6-dien-5-one |
|---|---|
| PubChem CID | 143469327 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-amino-8-octyl-1,2,4,8-tetrazabicyclo[4.2.0]octa-2,6-dien-5-one |
| SMILES | CCCCCCCCn1cc2c(=O)[nH]c(N)nn21 |
| InChI | InChI=1S/C12H21N5O/c1-2-3-4-5-6-7-8-16-9-10-11(18)14-12(13)15-17(10)16/h9H,2-8H2,1H3,(H3,13,14,15,18) |
| InChIKey | RZEJKVWKSWRPLV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 81.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|