C33H44FN7O2 — CID 143470926
ethoxyethane;3-[4-[[2-ethyl-6-[(E)-[(5-fluoropyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol;N-ethyl-N-methylethanamine (PubChem CID 143470926) has the molecular formula C33H44FN7O2 and a molecular weight of 589.76 g/mol. Its IUPAC name is ethoxyethane;3-[4-[[2-ethyl-6-[(E)-[(5-fluoropyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol;N-ethyl-N-methylethanamine.
| Compound Name | ethoxyethane;3-[4-[[2-ethyl-6-[(E)-[(5-fluoropyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol;N-ethyl-N-methylethanamine |
|---|---|
| PubChem CID | 143470926 |
| Molecular Formula | C33H44FN7O2 |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.35 |
| IUPAC Name | ethoxyethane;3-[4-[[2-ethyl-6-[(E)-[(5-fluoropyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol;N-ethyl-N-methylethanamine |
| SMILES | CCN(C)CC.CCOCC.CCc1nc(/C=N/Nc2ncc(F)cn2)ccc1Nc1ccc(-c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C24H21FN6O.C5H13N.C4H10O/c1-2-22-23(11-10-20(30-22)15-28-31-24-26-13-18(25)14-27-24)29-19-8-6-16(7-9-19)17-4-3-5-21(32)12-17;1-4-6(3)5-2;1-3-5-4-2/h3-15,29,32H,2H2,1H3,(H,26,27,31);4-5H2,1-3H3;3-4H2,1-2H3/b28-15+;; |
| InChIKey | MRDGQSUIPKPXRC-XWVUSUPHSA-N |
| XLogP | 7.14 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|