C29H31FN7O2+ — CID 143471210
[(E)-[6-ethyl-5-[4-(3-hydroxyphenyl)anilino]-2-pyridinyl]methylideneamino]-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-methylazanium (PubChem CID 143471210) has the molecular formula C29H31FN7O2+ and a molecular weight of 528.61 g/mol. Its IUPAC name is [(E)-[6-ethyl-5-[4-(3-hydroxyphenyl)anilino]-2-pyridinyl]methylideneamino]-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-methylazanium.
| Compound Name | [(E)-[6-ethyl-5-[4-(3-hydroxyphenyl)anilino]-2-pyridinyl]methylideneamino]-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-methylazanium |
|---|---|
| PubChem CID | 143471210 |
| Molecular Formula | C29H31FN7O2+ |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | [(E)-[6-ethyl-5-[4-(3-hydroxyphenyl)anilino]-2-pyridinyl]methylideneamino]-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-methylazanium |
| SMILES | CCc1nc(/C=N/[NH+](C)c2ncc(F)c(N3CCOCC3)n2)ccc1Nc1ccc(-c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C29H30FN7O2/c1-3-26-27(33-22-9-7-20(8-10-22)21-5-4-6-24(38)17-21)12-11-23(34-26)18-32-36(2)29-31-19-25(30)28(35-29)37-13-15-39-16-14-37/h4-12,17-19,33,38H,3,13-16H2,1-2H3/p+1/b32-18+ |
| InChIKey | JITOZEDQQANILN-KCSSXMTESA-O |
| XLogP | 3.71 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|