C30H32FN7O2 — CID 58877066
3-[4-[[2-ethyl-6-[(E)-[[4-(2-ethylmorpholin-4-yl)-5-fluoropyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol (PubChem CID 58877066) has the molecular formula C30H32FN7O2 and a molecular weight of 541.63 g/mol. Its IUPAC name is 3-[4-[[2-ethyl-6-[(E)-[[4-(2-ethylmorpholin-4-yl)-5-fluoropyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol.
| Compound Name | 3-[4-[[2-ethyl-6-[(E)-[[4-(2-ethylmorpholin-4-yl)-5-fluoropyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol |
|---|---|
| PubChem CID | 58877066 |
| Molecular Formula | C30H32FN7O2 |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 3-[4-[[2-ethyl-6-[(E)-[[4-(2-ethylmorpholin-4-yl)-5-fluoropyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol |
| SMILES | CCc1nc(/C=N/Nc2ncc(F)c(N3CCOC(CC)C3)n2)ccc1Nc1ccc(-c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C30H32FN7O2/c1-3-25-19-38(14-15-40-25)29-26(31)18-32-30(36-29)37-33-17-23-12-13-28(27(4-2)35-23)34-22-10-8-20(9-11-22)21-6-5-7-24(39)16-21/h5-13,16-18,25,34,39H,3-4,14-15,19H2,1-2H3,(H,32,36,37)/b33-17+ |
| InChIKey | GDTAEGUGWFRIGB-ATZGPIRCSA-N |
| XLogP | 5.75 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|