C24H21FN6O — CID 143471192
3-[4-[[6-[(E)-[(5-fluoro-4-methylpyrimidin-2-yl)hydrazinylidene]methyl]-2-methyl-3-pyridinyl]amino]phenyl]phenol (PubChem CID 143471192) has the molecular formula C24H21FN6O and a molecular weight of 428.47 g/mol. Its IUPAC name is 3-[4-[[6-[(E)-[(5-fluoro-4-methylpyrimidin-2-yl)hydrazinylidene]methyl]-2-methyl-3-pyridinyl]amino]phenyl]phenol.
| Compound Name | 3-[4-[[6-[(E)-[(5-fluoro-4-methylpyrimidin-2-yl)hydrazinylidene]methyl]-2-methyl-3-pyridinyl]amino]phenyl]phenol |
|---|---|
| PubChem CID | 143471192 |
| Molecular Formula | C24H21FN6O |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-[4-[[6-[(E)-[(5-fluoro-4-methylpyrimidin-2-yl)hydrazinylidene]methyl]-2-methyl-3-pyridinyl]amino]phenyl]phenol |
| SMILES | Cc1nc(N/N=C/c2ccc(Nc3ccc(-c4cccc(O)c4)cc3)c(C)n2)ncc1F |
| InChI | InChI=1S/C24H21FN6O/c1-15-22(25)14-26-24(29-15)31-27-13-20-10-11-23(16(2)28-20)30-19-8-6-17(7-9-19)18-4-3-5-21(32)12-18/h3-14,30,32H,1-2H3,(H,26,29,31)/b27-13+ |
| InChIKey | RSHCHIZHBJIYSO-UVHMKAGCSA-N |
| XLogP | 5.19 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|