C27H30N8O2 — CID 146370542
3-[4-[[6-[(E)-[[4-[2-(2-hydroxyethylamino)ethylamino]-6-methylpyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol (PubChem CID 146370542) has the molecular formula C27H30N8O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 3-[4-[[6-[(E)-[[4-[2-(2-hydroxyethylamino)ethylamino]-6-methylpyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol.
| Compound Name | 3-[4-[[6-[(E)-[[4-[2-(2-hydroxyethylamino)ethylamino]-6-methylpyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol |
|---|---|
| PubChem CID | 146370542 |
| Molecular Formula | C27H30N8O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 3-[4-[[6-[(E)-[[4-[2-(2-hydroxyethylamino)ethylamino]-6-methylpyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]phenol |
| SMILES | Cc1cc(NCCNCCO)nc(N/N=C/c2ccc(Nc3ccc(-c4cccc(O)c4)cc3)cn2)n1 |
| InChI | InChI=1S/C27H30N8O2/c1-19-15-26(29-12-11-28-13-14-36)34-27(32-19)35-31-18-23-9-10-24(17-30-23)33-22-7-5-20(6-8-22)21-3-2-4-25(37)16-21/h2-10,15-18,28,33,36-37H,11-14H2,1H3,(H2,29,32,34,35)/b31-18+ |
| InChIKey | ZCONXCHYNRMRKV-FDAWAROLSA-N |
| XLogP | 3.74 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|