C20H24BrNO — CID 143477707
(3Z,7E)-7-(bromomethylidene)-3a-methyl-3-[(2-phenylethylamino)methylidene]-4,5,6,7a-tetrahydro-1H-inden-2-one (PubChem CID 143477707) has the molecular formula C20H24BrNO and a molecular weight of 374.32 g/mol. Its IUPAC name is (3Z,7E)-7-(bromomethylidene)-3a-methyl-3-[(2-phenylethylamino)methylidene]-4,5,6,7a-tetrahydro-1H-inden-2-one.
| Compound Name | (3Z,7E)-7-(bromomethylidene)-3a-methyl-3-[(2-phenylethylamino)methylidene]-4,5,6,7a-tetrahydro-1H-inden-2-one |
|---|---|
| PubChem CID | 143477707 |
| Molecular Formula | C20H24BrNO |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (3Z,7E)-7-(bromomethylidene)-3a-methyl-3-[(2-phenylethylamino)methylidene]-4,5,6,7a-tetrahydro-1H-inden-2-one |
| SMILES | CC12CCC/C(=C\Br)C1CC(=O)/C2=C\NCCc1ccccc1 |
| InChI | InChI=1S/C20H24BrNO/c1-20-10-5-8-16(13-21)17(20)12-19(23)18(20)14-22-11-9-15-6-3-2-4-7-15/h2-4,6-7,13-14,17,22H,5,8-12H2,1H3/b16-13+,18-14+ |
| InChIKey | HNXQBGHQMWMMEQ-KSQUNMIPSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|