C19H25NO — CID 10850573
(4S,4aS)-1-benzyl-4,4a,8-trimethyl-4,5,6,7-tetrahydro-3H-quinolin-2-one (PubChem CID 10850573) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is (4S,4aS)-1-benzyl-4,4a,8-trimethyl-4,5,6,7-tetrahydro-3H-quinolin-2-one.
| Compound Name | (4S,4aS)-1-benzyl-4,4a,8-trimethyl-4,5,6,7-tetrahydro-3H-quinolin-2-one |
|---|---|
| PubChem CID | 10850573 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (4S,4aS)-1-benzyl-4,4a,8-trimethyl-4,5,6,7-tetrahydro-3H-quinolin-2-one |
| SMILES | CC1=C2N(Cc3ccccc3)C(=O)C[C@H](C)[C@]2(C)CCC1 |
| InChI | InChI=1S/C19H25NO/c1-14-8-7-11-19(3)15(2)12-17(21)20(18(14)19)13-16-9-5-4-6-10-16/h4-6,9-10,15H,7-8,11-13H2,1-3H3/t15-,19-/m0/s1 |
| InChIKey | ZLNVGUQNCJDACV-KXBFYZLASA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |