About tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole
tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole (PubChem CID 143478725) has the molecular formula C15H27N3O2
and a molecular weight of 281.40 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole.
Molecular Properties
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole |
| PubChem CID | 143478725 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole |
| SMILES | CC(C)(C)OC(=O)N1CCCC1.CC(C)n1cccn1 |
| InChI | InChI=1S/C9H17NO2.C6H10N2/c1-9(2,3)12-8(11)10-6-4-5-7-10;1-6(2)8-5-3-4-7-8/h4-7H2,1-3H3;3-6H,1-2H3 |
| InChIKey | SSCTVCDCXHVEES-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole?
The IUPAC name of tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole (CID 143478725) is tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole.
What is the SMILES notation for tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole?
The canonical SMILES for tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole is CC(C)(C)OC(=O)N1CCCC1.CC(C)n1cccn1.
What is the InChIKey of tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole?
The InChIKey is SSCTVCDCXHVEES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C6H10N2/c1-9(2,3)12-8(11)10-6-4-5-7-10;1-6(2)8-5-3-4-7-8/h4-7H2,1-3H3;3-6H,1-2H3.
What are the key properties of tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole?
tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole has a molecular weight of 281.40 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl pyrrolidine-1-carboxylate;1-propan-2-ylpyrazole is sourced from PubChem (CID 143478725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).