C11H14N2 — CID 143483242
5-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-1H-pyrazole (PubChem CID 143483242) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 5-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-1H-pyrazole.
| Compound Name | 5-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 143483242 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 5-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-1H-pyrazole |
| SMILES | C=C(C)/C=C(/C=C\C)c1ccn[nH]1 |
| InChI | InChI=1S/C11H14N2/c1-4-5-10(8-9(2)3)11-6-7-12-13-11/h4-8H,2H2,1,3H3,(H,12,13)/b5-4-,10-8+ |
| InChIKey | PYKDQJBBRNKKSO-BTCMVDHLSA-N |
| XLogP | 2.95 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|