About ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate
ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate (PubChem CID 143493142) has the molecular formula C23H44O6
and a molecular weight of 416.60 g/mol. Its IUPAC name is ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate.
Molecular Properties
| Compound Name | ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate |
| PubChem CID | 143493142 |
| Molecular Formula | C23H44O6 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate |
| SMILES | C=C(C)C(=O)OCCOC(O)C1CCCCC1OC(=O)C(CC)CC.CC.CC |
| InChI | InChI=1S/C19H32O6.2C2H6/c1-5-14(6-2)18(21)25-16-10-8-7-9-15(16)19(22)24-12-11-23-17(20)13(3)4;2*1-2/h14-16,19,22H,3,5-12H2,1-2,4H3;2*1-2H3 |
| InChIKey | LIQXXZOCTDIOQZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate?
The IUPAC name of ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate (CID 143493142) is ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate.
What is the SMILES notation for ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate?
The canonical SMILES for ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate is C=C(C)C(=O)OCCOC(O)C1CCCCC1OC(=O)C(CC)CC.CC.CC.
What is the InChIKey of ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate?
The InChIKey is LIQXXZOCTDIOQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O6.2C2H6/c1-5-14(6-2)18(21)25-16-10-8-7-9-15(16)19(22)24-12-11-23-17(20)13(3)4;2*1-2/h14-16,19,22H,3,5-12H2,1-2,4H3;2*1-2H3.
What are the key properties of ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate?
ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate has a molecular weight of 416.60 g/mol, XLogP of 5.03, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]methyl]cyclohexyl] 2-ethylbutanoate is sourced from PubChem (CID 143493142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).