About ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride
ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride (PubChem CID 143502148) has the molecular formula C15H26FNO
and a molecular weight of 255.38 g/mol. Its IUPAC name is ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride.
Molecular Properties
| Compound Name | ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride |
| PubChem CID | 143502148 |
| Molecular Formula | C15H26FNO |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride |
| SMILES | CC.CCC1=CC(N2CCOCC2)=CC2CC12.F |
| InChI | InChI=1S/C13H19NO.C2H6.FH/c1-2-10-7-12(8-11-9-13(10)11)14-3-5-15-6-4-14;1-2;/h7-8,11,13H,2-6,9H2,1H3;1-2H3;1H |
| InChIKey | CPERZCFBQUPRCG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride?
The IUPAC name of ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride (CID 143502148) is ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride.
What is the SMILES notation for ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride?
The canonical SMILES for ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride is CC.CCC1=CC(N2CCOCC2)=CC2CC12.F.
What is the InChIKey of ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride?
The InChIKey is CPERZCFBQUPRCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO.C2H6.FH/c1-2-10-7-12(8-11-9-13(10)11)14-3-5-15-6-4-14;1-2;/h7-8,11,13H,2-6,9H2,1H3;1-2H3;1H.
What are the key properties of ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride?
ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride has a molecular weight of 255.38 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(5-ethyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)morpholine;hydrofluoride is sourced from PubChem (CID 143502148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).