C18H15N3O2 — CID 143512787
5-[(6E)-9-(3H-azepin-6-yl)nona-1,6-dien-4,8-diyn-3-yl]imidazolidine-2,4-dione (PubChem CID 143512787) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 5-[(6E)-9-(3H-azepin-6-yl)nona-1,6-dien-4,8-diyn-3-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[(6E)-9-(3H-azepin-6-yl)nona-1,6-dien-4,8-diyn-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143512787 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-[(6E)-9-(3H-azepin-6-yl)nona-1,6-dien-4,8-diyn-3-yl]imidazolidine-2,4-dione |
| SMILES | C=CC(C#C/C=C/C#CC1=CN=CCC=C1)C1NC(=O)NC1=O |
| InChI | InChI=1S/C18H15N3O2/c1-2-15(16-17(22)21-18(23)20-16)11-6-4-3-5-9-14-10-7-8-12-19-13-14/h2-4,7,10,12-13,15-16H,1,8H2,(H2,20,21,22,23)/b4-3+ |
| InChIKey | LPKYBPAMBKNHPR-ONEGZZNKSA-N |
| XLogP | 1.47 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|