C24H32N4O2S — CID 143516227
(E)-3-(6-amino-5-ethyl-3-pyridinyl)-N-(6-hydroxy-1,3-benzothiazol-2-yl)prop-2-enamide;heptane (PubChem CID 143516227) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is (E)-3-(6-amino-5-ethyl-3-pyridinyl)-N-(6-hydroxy-1,3-benzothiazol-2-yl)prop-2-enamide;heptane.
| Compound Name | (E)-3-(6-amino-5-ethyl-3-pyridinyl)-N-(6-hydroxy-1,3-benzothiazol-2-yl)prop-2-enamide;heptane |
|---|---|
| PubChem CID | 143516227 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (E)-3-(6-amino-5-ethyl-3-pyridinyl)-N-(6-hydroxy-1,3-benzothiazol-2-yl)prop-2-enamide;heptane |
| SMILES | CCCCCCC.CCc1cc(/C=C/C(=O)Nc2nc3ccc(O)cc3s2)cnc1N |
| InChI | InChI=1S/C17H16N4O2S.C7H16/c1-2-11-7-10(9-19-16(11)18)3-6-15(23)21-17-20-13-5-4-12(22)8-14(13)24-17;1-3-5-7-6-4-2/h3-9,22H,2H2,1H3,(H2,18,19)(H,20,21,23);3-7H2,1-2H3/b6-3+; |
| InChIKey | YOLRNGBRKPWDGJ-ZIKNSQGESA-N |
| XLogP | 6.17 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|