C21H22FN5OS — CID 143516441
(E)-3-[6-amino-5-(piperidin-1-ylmethyl)-3-pyridinyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 143516441) has the molecular formula C21H22FN5OS and a molecular weight of 411.51 g/mol. Its IUPAC name is (E)-3-[6-amino-5-(piperidin-1-ylmethyl)-3-pyridinyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[6-amino-5-(piperidin-1-ylmethyl)-3-pyridinyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 143516441 |
| Molecular Formula | C21H22FN5OS |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (E)-3-[6-amino-5-(piperidin-1-ylmethyl)-3-pyridinyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | Nc1ncc(/C=C/C(=O)Nc2nc3ccc(F)cc3s2)cc1CN1CCCCC1 |
| InChI | InChI=1S/C21H22FN5OS/c22-16-5-6-17-18(11-16)29-21(25-17)26-19(28)7-4-14-10-15(20(23)24-12-14)13-27-8-2-1-3-9-27/h4-7,10-12H,1-3,8-9,13H2,(H2,23,24)(H,25,26,28)/b7-4+ |
| InChIKey | RMSPNOPFIZQTFU-QPJJXVBHSA-N |
| XLogP | 4.05 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|