C15H15N3OS7 — CID 143516895
[[5-(6-methoxy-1,3-benzothiazol-2-yl)-2-pyridinyl]-[tris(sulfanyl)methyl]amino]methanetrithiol (PubChem CID 143516895) has the molecular formula C15H15N3OS7 and a molecular weight of 477.77 g/mol. Its IUPAC name is [[5-(6-methoxy-1,3-benzothiazol-2-yl)-2-pyridinyl]-[tris(sulfanyl)methyl]amino]methanetrithiol.
| Compound Name | [[5-(6-methoxy-1,3-benzothiazol-2-yl)-2-pyridinyl]-[tris(sulfanyl)methyl]amino]methanetrithiol |
|---|---|
| PubChem CID | 143516895 |
| Molecular Formula | C15H15N3OS7 |
| Molecular Weight | 477.77 g/mol |
| Exact Mass | 476.93 |
| IUPAC Name | [[5-(6-methoxy-1,3-benzothiazol-2-yl)-2-pyridinyl]-[tris(sulfanyl)methyl]amino]methanetrithiol |
| SMILES | COc1ccc2nc(-c3ccc(N(C(S)(S)S)C(S)(S)S)nc3)sc2c1 |
| InChI | InChI=1S/C15H15N3OS7/c1-19-9-3-4-10-11(6-9)26-13(17-10)8-2-5-12(16-7-8)18(14(20,21)22)15(23,24)25/h2-7,20-25H,1H3 |
| InChIKey | WJDGHEAGDDFFQL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.77 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|