C19H16BrN2O5- — CID 143522991
[4-(bromomethyl)-3-[[3-(oxidoamino)phenyl]methyl]-2-oxochromen-7-yl] N-methylcarbamate (PubChem CID 143522991) has the molecular formula C19H16BrN2O5- and a molecular weight of 432.25 g/mol. Its IUPAC name is [4-(bromomethyl)-3-[[3-(oxidoamino)phenyl]methyl]-2-oxochromen-7-yl] N-methylcarbamate.
| Compound Name | [4-(bromomethyl)-3-[[3-(oxidoamino)phenyl]methyl]-2-oxochromen-7-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 143522991 |
| Molecular Formula | C19H16BrN2O5- |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | [4-(bromomethyl)-3-[[3-(oxidoamino)phenyl]methyl]-2-oxochromen-7-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc2c(CBr)c(Cc3cccc(N[O-])c3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H16BrN2O5/c1-21-19(24)26-13-5-6-14-16(10-20)15(18(23)27-17(14)9-13)8-11-3-2-4-12(7-11)22-25/h2-7,9,22H,8,10H2,1H3,(H,21,24)/q-1 |
| InChIKey | IGPYLHMGEROBFL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|