C19H24N4O7 — CID 143532200
tert-butyl N-[(6S)-6-[(3,5-dinitrobenzoyl)-methylamino]cyclohex-3-en-1-yl]carbamate (PubChem CID 143532200) has the molecular formula C19H24N4O7 and a molecular weight of 420.42 g/mol. Its IUPAC name is tert-butyl N-[(6S)-6-[(3,5-dinitrobenzoyl)-methylamino]cyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(6S)-6-[(3,5-dinitrobenzoyl)-methylamino]cyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 143532200 |
| Molecular Formula | C19H24N4O7 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | tert-butyl N-[(6S)-6-[(3,5-dinitrobenzoyl)-methylamino]cyclohex-3-en-1-yl]carbamate |
| SMILES | CN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)[C@H]1CC=CCC1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24N4O7/c1-19(2,3)30-18(25)20-15-7-5-6-8-16(15)21(4)17(24)12-9-13(22(26)27)11-14(10-12)23(28)29/h5-6,9-11,15-16H,7-8H2,1-4H3,(H,20,25)/t15?,16-/m0/s1 |
| InChIKey | NATKLLQLUZQHAK-LYKKTTPLSA-N |
| XLogP | 3.19 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|