C19H18ClN3OS — CID 143535927
2-[5-chloro-2-(1,3-thiazol-2-ylmethyl)-1H-indol-3-yl]-N-(furan-2-ylmethyl)ethanamine (PubChem CID 143535927) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is 2-[5-chloro-2-(1,3-thiazol-2-ylmethyl)-1H-indol-3-yl]-N-(furan-2-ylmethyl)ethanamine.
| Compound Name | 2-[5-chloro-2-(1,3-thiazol-2-ylmethyl)-1H-indol-3-yl]-N-(furan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 143535927 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[5-chloro-2-(1,3-thiazol-2-ylmethyl)-1H-indol-3-yl]-N-(furan-2-ylmethyl)ethanamine |
| SMILES | Clc1ccc2[nH]c(Cc3nccs3)c(CCNCc3ccco3)c2c1 |
| InChI | InChI=1S/C19H18ClN3OS/c20-13-3-4-17-16(10-13)15(5-6-21-12-14-2-1-8-24-14)18(23-17)11-19-22-7-9-25-19/h1-4,7-10,21,23H,5-6,11-12H2 |
| InChIKey | PHSKJGOTPDEKJH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|