About N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide
N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide (PubChem CID 143542459) has the molecular formula C20H20N2OS
and a molecular weight of 336.46 g/mol. Its IUPAC name is N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide.
Molecular Properties
| Compound Name | N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide |
| PubChem CID | 143542459 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide |
| SMILES | CN1CCc2cc(NS(=O)c3ccc4ccccc4c3)ccc2C1 |
| InChI | InChI=1S/C20H20N2OS/c1-22-11-10-17-12-19(8-6-18(17)14-22)21-24(23)20-9-7-15-4-2-3-5-16(15)13-20/h2-9,12-13,21H,10-11,14H2,1H3 |
| InChIKey | GALIVUZZNSYILY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide?
The IUPAC name of N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide (CID 143542459) is N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide.
What is the SMILES notation for N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide?
The canonical SMILES for N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide is CN1CCc2cc(NS(=O)c3ccc4ccccc4c3)ccc2C1.
What is the InChIKey of N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide?
The InChIKey is GALIVUZZNSYILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2OS/c1-22-11-10-17-12-19(8-6-18(17)14-22)21-24(23)20-9-7-15-4-2-3-5-16(15)13-20/h2-9,12-13,21H,10-11,14H2,1H3.
What are the key properties of N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide?
N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide has a molecular weight of 336.46 g/mol, XLogP of 3.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)naphthalene-2-sulfinamide is sourced from PubChem (CID 143542459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).