About [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate
[3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate (PubChem CID 143546080) has the molecular formula C11H24NO5P
and a molecular weight of 281.29 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate.
Molecular Properties
| Compound Name | [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate |
| PubChem CID | 143546080 |
| Molecular Formula | C11H24NO5P |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate |
| SMILES | C=P(O)(OCCN(C)C)OCC(C)COC(C)=O |
| InChI | InChI=1S/C11H24NO5P/c1-10(8-15-11(2)13)9-17-18(5,14)16-7-6-12(3)4/h10,14H,5-9H2,1-4H3 |
| InChIKey | PTNSRMOHIDDMIP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate?
The IUPAC name of [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate (CID 143546080) is [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate.
What is the SMILES notation for [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate?
The canonical SMILES for [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate is C=P(O)(OCCN(C)C)OCC(C)COC(C)=O.
What is the InChIKey of [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate?
The InChIKey is PTNSRMOHIDDMIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24NO5P/c1-10(8-15-11(2)13)9-17-18(5,14)16-7-6-12(3)4/h10,14H,5-9H2,1-4H3.
What are the key properties of [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate?
[3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate has a molecular weight of 281.29 g/mol, XLogP of 0.97, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(dimethylamino)ethoxy-hydroxy-methylidene-λ5-phosphanyl]oxy-2-methylpropyl] acetate is sourced from PubChem (CID 143546080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).