C10H20NO7P — CID 143546082
[2-[[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxymethyl]-3-oxopropyl] acetate (PubChem CID 143546082) has the molecular formula C10H20NO7P and a molecular weight of 297.24 g/mol. Its IUPAC name is [2-[[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxymethyl]-3-oxopropyl] acetate.
| Compound Name | [2-[[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxymethyl]-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 143546082 |
| Molecular Formula | C10H20NO7P |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [2-[[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxymethyl]-3-oxopropyl] acetate |
| SMILES | CC(=O)OCC(C=O)COP(=O)(O)OCCN(C)C |
| InChI | InChI=1S/C10H20NO7P/c1-9(13)16-7-10(6-12)8-18-19(14,15)17-5-4-11(2)3/h6,10H,4-5,7-8H2,1-3H3,(H,14,15) |
| InChIKey | NVIHLCZLSMXTJJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|