C12H21Br — CID 143546119
(3Z,5Z)-3-bromo-4-tert-butylocta-3,5-diene (PubChem CID 143546119) has the molecular formula C12H21Br and a molecular weight of 245.20 g/mol. Its IUPAC name is (3Z,5Z)-3-bromo-4-tert-butylocta-3,5-diene.
| Compound Name | (3Z,5Z)-3-bromo-4-tert-butylocta-3,5-diene |
|---|---|
| PubChem CID | 143546119 |
| Molecular Formula | C12H21Br |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (3Z,5Z)-3-bromo-4-tert-butylocta-3,5-diene |
| SMILES | CC/C=C\C(=C(\Br)CC)C(C)(C)C |
| InChI | InChI=1S/C12H21Br/c1-6-8-9-10(11(13)7-2)12(3,4)5/h8-9H,6-7H2,1-5H3/b9-8-,11-10- |
| InChIKey | HWYLCBVRWJZADQ-XESWYYRISA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|