About 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium
1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium (PubChem CID 143546887) has the molecular formula C16H24N2S2+2
and a molecular weight of 308.52 g/mol. Its IUPAC name is 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium.
Molecular Properties
| Compound Name | 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium |
| PubChem CID | 143546887 |
| Molecular Formula | C16H24N2S2+2 |
| Molecular Weight | 308.52 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium |
| SMILES | CCSSCC[n+]1ccc(C)cc1.Cc1cc[nH+]cc1 |
| InChI | InChI=1S/C10H16NS2.C6H7N/c1-3-12-13-9-8-11-6-4-10(2)5-7-11;1-6-2-4-7-5-3-6/h4-7H,3,8-9H2,1-2H3;2-5H,1H3/q+1;/p+1 |
| InChIKey | RRJCAQNZJZSFED-UHFFFAOYSA-O |
| XLogP | 3.49 |
| TPSA | 18.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium?
The IUPAC name of 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium (CID 143546887) is 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium.
What is the SMILES notation for 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium?
The canonical SMILES for 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium is CCSSCC[n+]1ccc(C)cc1.Cc1cc[nH+]cc1.
What is the InChIKey of 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium?
The InChIKey is RRJCAQNZJZSFED-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H16NS2.C6H7N/c1-3-12-13-9-8-11-6-4-10(2)5-7-11;1-6-2-4-7-5-3-6/h4-7H,3,8-9H2,1-2H3;2-5H,1H3/q+1;/p+1.
What are the key properties of 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium?
1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium has a molecular weight of 308.52 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(ethyldisulfanyl)ethyl]-4-methylpyridin-1-ium;4-methylpyridin-1-ium is sourced from PubChem (CID 143546887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).