C37H56O8 — CID 143547251
[(4E)-7,10-dihydroxy-2-[(2E,4E)-7-hydroxy-11-methoxy-6,8,10-trimethyltrideca-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] benzoate (PubChem CID 143547251) has the molecular formula C37H56O8 and a molecular weight of 628.85 g/mol. Its IUPAC name is [(4E)-7,10-dihydroxy-2-[(2E,4E)-7-hydroxy-11-methoxy-6,8,10-trimethyltrideca-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] benzoate.
| Compound Name | [(4E)-7,10-dihydroxy-2-[(2E,4E)-7-hydroxy-11-methoxy-6,8,10-trimethyltrideca-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] benzoate |
|---|---|
| PubChem CID | 143547251 |
| Molecular Formula | C37H56O8 |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 628.40 |
| IUPAC Name | [(4E)-7,10-dihydroxy-2-[(2E,4E)-7-hydroxy-11-methoxy-6,8,10-trimethyltrideca-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] benzoate |
| SMILES | CCC(OC)C(C)CC(C)C(O)C(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(O)C(OC(=O)c2ccccc2)/C=C/C1C |
| InChI | InChI=1S/C37H56O8/c1-9-31(43-8)27(5)22-28(6)34(40)24(2)14-13-15-25(3)35-26(4)18-19-32(44-36(41)29-16-11-10-12-17-29)37(7,42)21-20-30(38)23-33(39)45-35/h10-19,24,26-28,30-32,34-35,38,40,42H,9,20-23H2,1-8H3/b14-13+,19-18+,25-15+ |
| InChIKey | JHDCFINIDZJIFW-PAKZOYIISA-N |
| XLogP | 6.20 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|