C38H67N3O9 — CID 89325817
[(4E)-2-[(2E,4E)-7,8-dihydroxy-11-methoxy-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-[3-(4-methylpiperazin-1-yl)propyl]carbamate (PubChem CID 89325817) has the molecular formula C38H67N3O9 and a molecular weight of 709.97 g/mol. Its IUPAC name is [(4E)-2-[(2E,4E)-7,8-dihydroxy-11-methoxy-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-[3-(4-methylpiperazin-1-yl)propyl]carbamate.
| Compound Name | [(4E)-2-[(2E,4E)-7,8-dihydroxy-11-methoxy-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-[3-(4-methylpiperazin-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 89325817 |
| Molecular Formula | C38H67N3O9 |
| Molecular Weight | 709.97 g/mol |
| Exact Mass | 709.49 |
| IUPAC Name | [(4E)-2-[(2E,4E)-7,8-dihydroxy-11-methoxy-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-[3-(4-methylpiperazin-1-yl)propyl]carbamate |
| SMILES | CCC(OC)C(C)CC(O)C(O)C(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(O)C(OC(=O)NCCCN2CCN(C)CC2)/C=C/C1C |
| InChI | InChI=1S/C38H67N3O9/c1-9-32(48-8)29(5)24-31(43)35(45)26(2)12-10-13-27(3)36-28(4)14-15-33(38(6,47)17-16-30(42)25-34(44)50-36)49-37(46)39-18-11-19-41-22-20-40(7)21-23-41/h10,12-15,26,28-33,35-36,42-43,45,47H,9,11,16-25H2,1-8H3,(H,39,46)/b12-10+,15-14+,27-13+ |
| InChIKey | JBILNBMQZZVJQD-PJDKVXTGSA-N |
| XLogP | 3.43 |
| TPSA | 161.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.97 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|