C26H40O5 — CID 14355065
5-[(E)-2-[(3S,4aR,6aR,8R,10aS,10bR)-8-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-3-yl]ethenyl]-5-methoxy-4-methylfuran-2-one (PubChem CID 14355065) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is 5-[(E)-2-[(3S,4aR,6aR,8R,10aS,10bR)-8-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-3-yl]ethenyl]-5-methoxy-4-methylfuran-2-one.
| Compound Name | 5-[(E)-2-[(3S,4aR,6aR,8R,10aS,10bR)-8-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-3-yl]ethenyl]-5-methoxy-4-methylfuran-2-one |
|---|---|
| PubChem CID | 14355065 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 5-[(E)-2-[(3S,4aR,6aR,8R,10aS,10bR)-8-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-3-yl]ethenyl]-5-methoxy-4-methylfuran-2-one |
| SMILES | COC1(/C=C/[C@]2(C)CC[C@@H]3[C@@]4(C)CC[C@@H](O)C(C)(C)[C@@H]4CC[C@@]3(C)O2)OC(=O)C=C1C |
| InChI | InChI=1S/C26H40O5/c1-17-16-21(28)30-26(17,29-7)15-14-23(4)11-8-19-24(5)12-10-20(27)22(2,3)18(24)9-13-25(19,6)31-23/h14-16,18-20,27H,8-13H2,1-7H3/b15-14+/t18-,19+,20+,23-,24-,25+,26?/m0/s1 |
| InChIKey | KOQSFTNOGWIFJZ-AJKQFAQASA-N |
| XLogP | 4.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|