C32H26O10 — CID 14355110
7,10-dihydroxy-5-methoxy-2-methyl-9-(2,7,10-trihydroxy-4-methoxy-7-methyl-5-oxo-6,8-dihydroanthracen-1-yl)anthracene-1,4-dione (PubChem CID 14355110) has the molecular formula C32H26O10 and a molecular weight of 570.55 g/mol. Its IUPAC name is 7,10-dihydroxy-5-methoxy-2-methyl-9-(2,7,10-trihydroxy-4-methoxy-7-methyl-5-oxo-6,8-dihydroanthracen-1-yl)anthracene-1,4-dione.
| Compound Name | 7,10-dihydroxy-5-methoxy-2-methyl-9-(2,7,10-trihydroxy-4-methoxy-7-methyl-5-oxo-6,8-dihydroanthracen-1-yl)anthracene-1,4-dione |
|---|---|
| PubChem CID | 14355110 |
| Molecular Formula | C32H26O10 |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 7,10-dihydroxy-5-methoxy-2-methyl-9-(2,7,10-trihydroxy-4-methoxy-7-methyl-5-oxo-6,8-dihydroanthracen-1-yl)anthracene-1,4-dione |
| SMILES | COc1cc(O)c(-c2c3c(c(O)c4c(OC)cc(O)cc24)C(=O)C=C(C)C3=O)c2cc3c(c(O)c12)C(=O)CC(C)(O)C3 |
| InChI | InChI=1S/C32H26O10/c1-12-5-17(34)27-28(29(12)37)26(16-7-14(33)8-20(41-3)25(16)31(27)39)23-15-6-13-10-32(2,40)11-19(36)22(13)30(38)24(15)21(42-4)9-18(23)35/h5-9,33,35,38-40H,10-11H2,1-4H3 |
| InChIKey | DCJYEFUZKKEXHM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'} |
|---|