C33H34O10 — CID 163083761
(5S,13R,23R)-3,13,19,23-tetrahydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(17),2(11),3,6,9,18,20(25),26,28-nonaene-15,21-dione (PubChem CID 163083761) has the molecular formula C33H34O10 and a molecular weight of 590.63 g/mol. Its IUPAC name is (5S,13R,23R)-3,13,19,23-tetrahydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(17),2(11),3,6,9,18,20(25),26,28-nonaene-15,21-dione.
| Compound Name | (5S,13R,23R)-3,13,19,23-tetrahydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(17),2(11),3,6,9,18,20(25),26,28-nonaene-15,21-dione |
|---|---|
| PubChem CID | 163083761 |
| Molecular Formula | C33H34O10 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | (5S,13R,23R)-3,13,19,23-tetrahydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(17),2(11),3,6,9,18,20(25),26,28-nonaene-15,21-dione |
| SMILES | COC1=C[C@H](OC)c2c(cc3c(c2O)-c2c(OC)cc4cc5c(c(O)c4c2OC(=O)C[C@](C)(O)C3)C(=O)C[C@](C)(O)C5)C1 |
| InChI | InChI=1S/C33H34O10/c1-32(38)11-17-7-16-9-21(41-4)28-26-18(6-15-8-19(40-3)10-22(42-5)25(15)30(26)37)12-33(2,39)14-23(35)43-31(28)27(16)29(36)24(17)20(34)13-32/h6-7,9-10,22,36-39H,8,11-14H2,1-5H3/t22-,32+,33+/m0/s1 |
| InChIKey | JPRQPYPJXWCEGT-FJGOTEAHSA-N |
| XLogP | 4.18 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|