C32H28O12 — CID 162984155
3,13,19,23,26-pentahydroxy-7,29-dimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(29),2,4(9),6,10,17,19,25,27-nonaene-5,8,15,21-tetrone (PubChem CID 162984155) has the molecular formula C32H28O12 and a molecular weight of 604.56 g/mol. Its IUPAC name is 3,13,19,23,26-pentahydroxy-7,29-dimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(29),2,4(9),6,10,17,19,25,27-nonaene-5,8,15,21-tetrone.
| Compound Name | 3,13,19,23,26-pentahydroxy-7,29-dimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(29),2,4(9),6,10,17,19,25,27-nonaene-5,8,15,21-tetrone |
|---|---|
| PubChem CID | 162984155 |
| Molecular Formula | C32H28O12 |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 3,13,19,23,26-pentahydroxy-7,29-dimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(29),2,4(9),6,10,17,19,25,27-nonaene-5,8,15,21-tetrone |
| SMILES | COC1=CC(=O)c2c(cc3c(c2O)-c2c(OC)cc4c(O)c5c(c(O)c4c2OC(=O)CC(C)(O)C3)C(=O)CC(C)(O)C5)C1=O |
| InChI | InChI=1S/C32H28O12/c1-31(40)8-12-5-13-22(16(33)7-19(43-4)27(13)37)28(38)21(12)25-18(42-3)6-14-24(30(25)44-20(35)11-31)29(39)23-15(26(14)36)9-32(2,41)10-17(23)34/h5-7,36,38-41H,8-11H2,1-4H3 |
| InChIKey | PXXNCIIRMHDWAP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 197.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|