C64H62 — CID 143551475
12-(2,7-ditert-butyl-9-ethyl-9-methylfluoren-4-yl)-7-(2,6-diphenylphenyl)benzo[k]fluoranthene;methane (PubChem CID 143551475) has the molecular formula C64H62 and a molecular weight of 831.20 g/mol. Its IUPAC name is 12-(2,7-ditert-butyl-9-ethyl-9-methylfluoren-4-yl)-7-(2,6-diphenylphenyl)benzo[k]fluoranthene;methane.
| Compound Name | 12-(2,7-ditert-butyl-9-ethyl-9-methylfluoren-4-yl)-7-(2,6-diphenylphenyl)benzo[k]fluoranthene;methane |
|---|---|
| PubChem CID | 143551475 |
| Molecular Formula | C64H62 |
| Molecular Weight | 831.20 g/mol |
| Exact Mass | 830.49 |
| IUPAC Name | 12-(2,7-ditert-butyl-9-ethyl-9-methylfluoren-4-yl)-7-(2,6-diphenylphenyl)benzo[k]fluoranthene;methane |
| SMILES | C.C.CCC1(C)c2cc(C(C)(C)C)ccc2-c2c(-c3c4c(c(-c5c(-c6ccccc6)cccc5-c5ccccc5)c5ccccc35)-c3cccc5cccc-4c35)cc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C62H54.2CH4/c1-9-62(8)51-36-41(60(2,3)4)33-34-47(51)54-50(35-42(37-52(54)62)61(5,6)7)56-45-27-16-17-28-46(45)57(59-49-32-19-26-40-25-18-31-48(53(40)49)58(56)59)55-43(38-21-12-10-13-22-38)29-20-30-44(55)39-23-14-11-15-24-39;;/h10-37H,9H2,1-8H3;2*1H4 |
| InChIKey | MHFAPVXCVIZTPN-UHFFFAOYSA-N |
| XLogP | 18.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.20 |
| LogP ≤ 5 | 18.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |