C19H22N2O4 — CID 143556630
3-[5-(4-ethylphenyl)-1,3,4-oxadiazol-2-yl]benzaldehyde;methanol (PubChem CID 143556630) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-[5-(4-ethylphenyl)-1,3,4-oxadiazol-2-yl]benzaldehyde;methanol.
| Compound Name | 3-[5-(4-ethylphenyl)-1,3,4-oxadiazol-2-yl]benzaldehyde;methanol |
|---|---|
| PubChem CID | 143556630 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-[5-(4-ethylphenyl)-1,3,4-oxadiazol-2-yl]benzaldehyde;methanol |
| SMILES | CCc1ccc(-c2nnc(-c3cccc(C=O)c3)o2)cc1.CO.CO |
| InChI | InChI=1S/C17H14N2O2.2CH4O/c1-2-12-6-8-14(9-7-12)16-18-19-17(21-16)15-5-3-4-13(10-15)11-20;2*1-2/h3-11H,2H2,1H3;2*2H,1H3 |
| InChIKey | ZSGSHORBURYYSA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|