C22H35N5O2 — CID 143563360
2-(2-cyclodecylethoxy)-9-(5-methyloxolan-2-yl)purin-6-amine (PubChem CID 143563360) has the molecular formula C22H35N5O2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 2-(2-cyclodecylethoxy)-9-(5-methyloxolan-2-yl)purin-6-amine.
| Compound Name | 2-(2-cyclodecylethoxy)-9-(5-methyloxolan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 143563360 |
| Molecular Formula | C22H35N5O2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 2-(2-cyclodecylethoxy)-9-(5-methyloxolan-2-yl)purin-6-amine |
| SMILES | CC1CCC(n2cnc3c(N)nc(OCCC4CCCCCCCCC4)nc32)O1 |
| InChI | InChI=1S/C22H35N5O2/c1-16-11-12-18(29-16)27-15-24-19-20(23)25-22(26-21(19)27)28-14-13-17-9-7-5-3-2-4-6-8-10-17/h15-18H,2-14H2,1H3,(H2,23,25,26) |
| InChIKey | MCLXPONZXJHEMB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |