C20H30N2 — CID 143565470
(Z,2E)-N-methyl-2-prop-2-enylidene-11-(4H-pyridin-1-yl)undec-3-en-1-imine (PubChem CID 143565470) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (Z,2E)-N-methyl-2-prop-2-enylidene-11-(4H-pyridin-1-yl)undec-3-en-1-imine.
| Compound Name | (Z,2E)-N-methyl-2-prop-2-enylidene-11-(4H-pyridin-1-yl)undec-3-en-1-imine |
|---|---|
| PubChem CID | 143565470 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (Z,2E)-N-methyl-2-prop-2-enylidene-11-(4H-pyridin-1-yl)undec-3-en-1-imine |
| SMILES | C=C/C=C(\C=C/CCCCCCCN1C=CCC=C1)/C=N/C |
| InChI | InChI=1S/C20H30N2/c1-3-14-20(19-21-2)15-10-7-5-4-6-8-11-16-22-17-12-9-13-18-22/h3,10,12-15,17-19H,1,4-9,11,16H2,2H3/b15-10-,20-14+,21-19+ |
| InChIKey | YHUIUUXROUUCPX-NQOCPHKJSA-N |
| XLogP | 5.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|