C29H37N3 — CID 143571661
ethane;5-methyl-N-[6-[4-[4-(2-methylprop-2-enyl)cyclohexyl]phenyl]-3-pyridinyl]pyridin-2-amine (PubChem CID 143571661) has the molecular formula C29H37N3 and a molecular weight of 427.64 g/mol. Its IUPAC name is ethane;5-methyl-N-[6-[4-[4-(2-methylprop-2-enyl)cyclohexyl]phenyl]-3-pyridinyl]pyridin-2-amine.
| Compound Name | ethane;5-methyl-N-[6-[4-[4-(2-methylprop-2-enyl)cyclohexyl]phenyl]-3-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 143571661 |
| Molecular Formula | C29H37N3 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.30 |
| IUPAC Name | ethane;5-methyl-N-[6-[4-[4-(2-methylprop-2-enyl)cyclohexyl]phenyl]-3-pyridinyl]pyridin-2-amine |
| SMILES | C=C(C)CC1CCC(c2ccc(-c3ccc(Nc4ccc(C)cn4)cn3)cc2)CC1.CC |
| InChI | InChI=1S/C27H31N3.C2H6/c1-19(2)16-21-5-7-22(8-6-21)23-9-11-24(12-10-23)26-14-13-25(18-28-26)30-27-15-4-20(3)17-29-27;1-2/h4,9-15,17-18,21-22H,1,5-8,16H2,2-3H3,(H,29,30);1-2H3 |
| InChIKey | JHQWFXBVMWWBIC-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|