About 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane
2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane (PubChem CID 143576904) has the molecular formula C11H22ClN3O
and a molecular weight of 247.77 g/mol. Its IUPAC name is 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane.
Molecular Properties
| Compound Name | 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane |
| PubChem CID | 143576904 |
| Molecular Formula | C11H22ClN3O |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane |
| SMILES | CC.CC(N)CO.NNc1cccc(Cl)c1 |
| InChI | InChI=1S/C6H7ClN2.C3H9NO.C2H6/c7-5-2-1-3-6(4-5)9-8;1-3(4)2-5;1-2/h1-4,9H,8H2;3,5H,2,4H2,1H3;1-2H3 |
| InChIKey | YTXNFVCLNNLXRD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane?
The IUPAC name of 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane (CID 143576904) is 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane.
What is the SMILES notation for 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane?
The canonical SMILES for 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane is CC.CC(N)CO.NNc1cccc(Cl)c1.
What is the InChIKey of 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane?
The InChIKey is YTXNFVCLNNLXRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2.C3H9NO.C2H6/c7-5-2-1-3-6(4-5)9-8;1-3(4)2-5;1-2/h1-4,9H,8H2;3,5H,2,4H2,1H3;1-2H3.
What are the key properties of 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane?
2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane has a molecular weight of 247.77 g/mol, XLogP of 1.98, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropan-1-ol;(3-chlorophenyl)hydrazine;ethane is sourced from PubChem (CID 143576904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).