C11H8 — CID 143581465
1-ethynyl-3-propa-1,2-dienylbenzene (PubChem CID 143581465) has the molecular formula C11H8 and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-ethynyl-3-propa-1,2-dienylbenzene.
| Compound Name | 1-ethynyl-3-propa-1,2-dienylbenzene |
|---|---|
| PubChem CID | 143581465 |
| Molecular Formula | C11H8 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1-ethynyl-3-propa-1,2-dienylbenzene |
| SMILES | C#Cc1cccc(C=C=C)c1 |
| InChI | InChI=1S/C11H8/c1-3-6-11-8-5-7-10(4-2)9-11/h2,5-9H,1H2 |
| InChIKey | FSXOQKITHQDZNP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|