C29H33F7N2O3 — CID 143583372
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-7-(morpholin-4-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;1-fluoro-4-methylbenzene (PubChem CID 143583372) has the molecular formula C29H33F7N2O3 and a molecular weight of 590.58 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-7-(morpholin-4-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;1-fluoro-4-methylbenzene.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-7-(morpholin-4-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;1-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 143583372 |
| Molecular Formula | C29H33F7N2O3 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-7-(morpholin-4-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;1-fluoro-4-methylbenzene |
| SMILES | Cc1ccc(F)cc1.O=C1CC(CN2CCOCC2)CC2CC(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CN12 |
| InChI | InChI=1S/C22H26F6N2O3.C7H7F/c23-21(24,25)16-5-15(6-17(9-16)22(26,27)28)13-33-19-10-18-7-14(8-20(31)30(18)12-19)11-29-1-3-32-4-2-29;1-6-2-4-7(8)5-3-6/h5-6,9,14,18-19H,1-4,7-8,10-13H2;2-5H,1H3 |
| InChIKey | XBVJAXJLTVJNGC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |