C19H22F6N2O2 — CID 143583419
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-8-(dimethylamino)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 143583419) has the molecular formula C19H22F6N2O2 and a molecular weight of 424.39 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-8-(dimethylamino)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-8-(dimethylamino)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 143583419 |
| Molecular Formula | C19H22F6N2O2 |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-8-(dimethylamino)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CN(C)C1CCC(=O)N2CC(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC12 |
| InChI | InChI=1S/C19H22F6N2O2/c1-26(2)15-3-4-17(28)27-9-14(8-16(15)27)29-10-11-5-12(18(20,21)22)7-13(6-11)19(23,24)25/h5-7,14-16H,3-4,8-10H2,1-2H3 |
| InChIKey | OXDOAABBXCFMBE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |