C25H27F7N2O2 — CID 143583418
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-8-(dimethylamino)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene (PubChem CID 143583418) has the molecular formula C25H27F7N2O2 and a molecular weight of 520.49 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-8-(dimethylamino)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-8-(dimethylamino)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene |
|---|---|
| PubChem CID | 143583418 |
| Molecular Formula | C25H27F7N2O2 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-8-(dimethylamino)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene |
| SMILES | CN(C)C1CCC(=O)N2CC(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC12.Fc1ccccc1 |
| InChI | InChI=1S/C19H22F6N2O2.C6H5F/c1-26(2)15-3-4-17(28)27-9-14(8-16(15)27)29-10-11-5-12(18(20,21)22)7-13(6-11)19(23,24)25;7-6-4-2-1-3-5-6/h5-7,14-16H,3-4,8-10H2,1-2H3;1-5H |
| InChIKey | RENJYCIHAPURPA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |