C24H38FN3 — CID 143598690
1-ethyl-4-(2-fluorophenyl)piperazine;3-methylbut-3-enenitrile;methylcyclohexane (PubChem CID 143598690) has the molecular formula C24H38FN3 and a molecular weight of 387.59 g/mol. Its IUPAC name is 1-ethyl-4-(2-fluorophenyl)piperazine;3-methylbut-3-enenitrile;methylcyclohexane.
| Compound Name | 1-ethyl-4-(2-fluorophenyl)piperazine;3-methylbut-3-enenitrile;methylcyclohexane |
|---|---|
| PubChem CID | 143598690 |
| Molecular Formula | C24H38FN3 |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | 1-ethyl-4-(2-fluorophenyl)piperazine;3-methylbut-3-enenitrile;methylcyclohexane |
| SMILES | C=C(C)CC#N.CC1CCCCC1.CCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C12H17FN2.C7H14.C5H7N/c1-2-14-7-9-15(10-8-14)12-6-4-3-5-11(12)13;1-7-5-3-2-4-6-7;1-5(2)3-4-6/h3-6H,2,7-10H2,1H3;7H,2-6H2,1H3;1,3H2,2H3 |
| InChIKey | LYYCCURHYDSBKE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|