C22H36N4O — CID 143598575
1-ethyl-4-pyridin-4-ylpiperazine;methylcyclohexane;3-oxobutanenitrile (PubChem CID 143598575) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is 1-ethyl-4-pyridin-4-ylpiperazine;methylcyclohexane;3-oxobutanenitrile.
| Compound Name | 1-ethyl-4-pyridin-4-ylpiperazine;methylcyclohexane;3-oxobutanenitrile |
|---|---|
| PubChem CID | 143598575 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 1-ethyl-4-pyridin-4-ylpiperazine;methylcyclohexane;3-oxobutanenitrile |
| SMILES | CC(=O)CC#N.CC1CCCCC1.CCN1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C11H17N3.C7H14.C4H5NO/c1-2-13-7-9-14(10-8-13)11-3-5-12-6-4-11;1-7-5-3-2-4-6-7;1-4(6)2-3-5/h3-6H,2,7-10H2,1H3;7H,2-6H2,1H3;2H2,1H3 |
| InChIKey | REYVHJPSIYJNDC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |