C26H43N3O — CID 143598717
1-(3-ethoxyphenyl)-4-ethylpiperazine;3-methylbut-3-enenitrile;methylcyclohexane (PubChem CID 143598717) has the molecular formula C26H43N3O and a molecular weight of 413.65 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-4-ethylpiperazine;3-methylbut-3-enenitrile;methylcyclohexane.
| Compound Name | 1-(3-ethoxyphenyl)-4-ethylpiperazine;3-methylbut-3-enenitrile;methylcyclohexane |
|---|---|
| PubChem CID | 143598717 |
| Molecular Formula | C26H43N3O |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.34 |
| IUPAC Name | 1-(3-ethoxyphenyl)-4-ethylpiperazine;3-methylbut-3-enenitrile;methylcyclohexane |
| SMILES | C=C(C)CC#N.CC1CCCCC1.CCOc1cccc(N2CCN(CC)CC2)c1 |
| InChI | InChI=1S/C14H22N2O.C7H14.C5H7N/c1-3-15-8-10-16(11-9-15)13-6-5-7-14(12-13)17-4-2;1-7-5-3-2-4-6-7;1-5(2)3-4-6/h5-7,12H,3-4,8-11H2,1-2H3;7H,2-6H2,1H3;1,3H2,2H3 |
| InChIKey | TVBNOXRZAGRXKQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|