C8H10FNO — CID 143601210
2-fluoro-5-methylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 143601210) has the molecular formula C8H10FNO and a molecular weight of 155.17 g/mol. Its IUPAC name is 2-fluoro-5-methylcyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 2-fluoro-5-methylcyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 143601210 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 2-fluoro-5-methylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC1=CC(C(N)=O)=C(F)CC1 |
| InChI | InChI=1S/C8H10FNO/c1-5-2-3-7(9)6(4-5)8(10)11/h4H,2-3H2,1H3,(H2,10,11) |
| InChIKey | RIWLRNRVPUNUKX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |