C26H44N4O5S — CID 143601458
[(E)-but-1-enyl] (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-(4-nitrophenyl)propanimidothioate;ethane (PubChem CID 143601458) has the molecular formula C26H44N4O5S and a molecular weight of 524.73 g/mol. Its IUPAC name is [(E)-but-1-enyl] (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-(4-nitrophenyl)propanimidothioate;ethane.
| Compound Name | [(E)-but-1-enyl] (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-(4-nitrophenyl)propanimidothioate;ethane |
|---|---|
| PubChem CID | 143601458 |
| Molecular Formula | C26H44N4O5S |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | [(E)-but-1-enyl] (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-(4-nitrophenyl)propanimidothioate;ethane |
| SMILES | CC.CC.[H]/N=C(\S/C=C/CC)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)[C@H](CC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N4O5S.2C2H6/c1-6-8-13-32-19(23)18(14-15-9-11-16(12-10-15)26(29)30)24-20(27)17(7-2)25-21(28)31-22(3,4)5;2*1-2/h8-13,17-18,23H,6-7,14H2,1-5H3,(H,24,27)(H,25,28);2*1-2H3/b13-8+,23-19-;;/t17-,18-;;/m0../s1 |
| InChIKey | WKBBSTNFPAIVOG-ILXXLRPDSA-N |
| XLogP | 6.61 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|