C7H6BrNO — CID 143605008
2-bromo-5-methyl-4H-furo[3,2-b]pyrrole (PubChem CID 143605008) has the molecular formula C7H6BrNO and a molecular weight of 200.03 g/mol. Its IUPAC name is 2-bromo-5-methyl-4H-furo[3,2-b]pyrrole.
| Compound Name | 2-bromo-5-methyl-4H-furo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 143605008 |
| Molecular Formula | C7H6BrNO |
| Molecular Weight | 200.03 g/mol |
| Exact Mass | 198.96 |
| IUPAC Name | 2-bromo-5-methyl-4H-furo[3,2-b]pyrrole |
| SMILES | Cc1cc2oc(Br)cc2[nH]1 |
| InChI | InChI=1S/C7H6BrNO/c1-4-2-6-5(9-4)3-7(8)10-6/h2-3,9H,1H3 |
| InChIKey | RUNAYCQUTHGEDB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.03 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |