C12H22N2 — CID 143611261
N,1-diethyl-6-methylpyridin-2-imine;ethane (PubChem CID 143611261) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N,1-diethyl-6-methylpyridin-2-imine;ethane.
| Compound Name | N,1-diethyl-6-methylpyridin-2-imine;ethane |
|---|---|
| PubChem CID | 143611261 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N,1-diethyl-6-methylpyridin-2-imine;ethane |
| SMILES | CC.CC/N=c1\cccc(C)n1CC |
| InChI | InChI=1S/C10H16N2.C2H6/c1-4-11-10-8-6-7-9(3)12(10)5-2;1-2/h6-8H,4-5H2,1-3H3;1-2H3/b11-10+; |
| InChIKey | XKKPKDNBFYKAJH-ASTDGNLGSA-N |
| XLogP | 2.76 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |