C19H33NO — CID 143612207
(1E,3Z)-1-methoxy-4-propylocta-1,3-dien-1-amine;2-methylcyclohexa-1,3-diene (PubChem CID 143612207) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (1E,3Z)-1-methoxy-4-propylocta-1,3-dien-1-amine;2-methylcyclohexa-1,3-diene.
| Compound Name | (1E,3Z)-1-methoxy-4-propylocta-1,3-dien-1-amine;2-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143612207 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (1E,3Z)-1-methoxy-4-propylocta-1,3-dien-1-amine;2-methylcyclohexa-1,3-diene |
| SMILES | CC1=CCCC=C1.CCCC/C(=C\C=C(/N)OC)CCC |
| InChI | InChI=1S/C12H23NO.C7H10/c1-4-6-8-11(7-5-2)9-10-12(13)14-3;1-7-5-3-2-4-6-7/h9-10H,4-8,13H2,1-3H3;3,5-6H,2,4H2,1H3/b11-9-,12-10+; |
| InChIKey | FVEZVBXHIQZTBK-OWCKVOPESA-N |
| XLogP | 5.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|