C26H34N2 — CID 142162508
N'-[4-[(3Z)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylhepta-1,3,6-trien-4-yl]phenyl]pentanimidamide (PubChem CID 142162508) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is N'-[4-[(3Z)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylhepta-1,3,6-trien-4-yl]phenyl]pentanimidamide.
| Compound Name | N'-[4-[(3Z)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylhepta-1,3,6-trien-4-yl]phenyl]pentanimidamide |
|---|---|
| PubChem CID | 142162508 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | N'-[4-[(3Z)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylhepta-1,3,6-trien-4-yl]phenyl]pentanimidamide |
| SMILES | C=C(C/C(=C(\C)C(=C)C)c1ccc(/N=C(/N)CCCC)cc1)C1=CCCC=C1 |
| InChI | InChI=1S/C26H34N2/c1-6-7-13-26(27)28-24-16-14-23(15-17-24)25(21(5)19(2)3)18-20(4)22-11-9-8-10-12-22/h9,11-12,14-17H,2,4,6-8,10,13,18H2,1,3,5H3,(H2,27,28)/b25-21- |
| InChIKey | DINBERRLUDPHTL-DAFNUICNSA-N |
| XLogP | 7.44 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|