C25H31N3O2 — CID 143612788
2-[4-[4-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)piperazin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 143612788) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[4-[4-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)piperazin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)piperazin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143612788 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-[4-[4-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)piperazin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | CC1(C)C=CC=C(N2CCN(CCCCN3C(=O)c4ccccc4C3=O)CC2)C=C1 |
| InChI | InChI=1S/C25H31N3O2/c1-25(2)12-7-8-20(11-13-25)27-18-16-26(17-19-27)14-5-6-15-28-23(29)21-9-3-4-10-22(21)24(28)30/h3-4,7-13H,5-6,14-19H2,1-2H3 |
| InChIKey | GNSHQJSCUMFCOF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|